C15H22N2O3S — CID 170822751
S-[2,3-dihydroxy-3-(4-piperazin-1-ylphenyl)propyl] ethanethioate (PubChem CID 170822751) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-(4-piperazin-1-ylphenyl)propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-(4-piperazin-1-ylphenyl)propyl] ethanethioate |
|---|---|
| PubChem CID | 170822751 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | S-[2,3-dihydroxy-3-(4-piperazin-1-ylphenyl)propyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C15H22N2O3S/c1-11(18)21-10-14(19)15(20)12-2-4-13(5-3-12)17-8-6-16-7-9-17/h2-5,14-16,19-20H,6-10H2,1H3 |
| InChIKey | MDQHWEJGDKHAMY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|