About N-[2,3-dihydroxy-3-[5-(methoxymethyl)furan-2-yl]propyl]acetamide
N-[2,3-dihydroxy-3-[5-(methoxymethyl)furan-2-yl]propyl]acetamide (PubChem CID 170831484) has the molecular formula C11H17NO5
and a molecular weight of 243.26 g/mol. Its IUPAC name is N-[2,3-dihydroxy-3-[5-(methoxymethyl)furan-2-yl]propyl]acetamide.
Molecular Properties
| Compound Name | N-[2,3-dihydroxy-3-[5-(methoxymethyl)furan-2-yl]propyl]acetamide |
| PubChem CID | 170831484 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | N-[2,3-dihydroxy-3-[5-(methoxymethyl)furan-2-yl]propyl]acetamide |
| SMILES | COCc1ccc(C(O)C(O)CNC(C)=O)o1 |
| InChI | InChI=1S/C11H17NO5/c1-7(13)12-5-9(14)11(15)10-4-3-8(17-10)6-16-2/h3-4,9,11,14-15H,5-6H2,1-2H3,(H,12,13) |
| InChIKey | BPYINZQWQCNSOU-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2,3-dihydroxy-3-[5-(methoxymethyl)furan-2-yl]propyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,3-dihydroxy-3-[5-(methoxymethyl)furan-2-yl]propyl]acetamide?
The IUPAC name of N-[2,3-dihydroxy-3-[5-(methoxymethyl)furan-2-yl]propyl]acetamide (CID 170831484) is N-[2,3-dihydroxy-3-[5-(methoxymethyl)furan-2-yl]propyl]acetamide.
What is the SMILES notation for N-[2,3-dihydroxy-3-[5-(methoxymethyl)furan-2-yl]propyl]acetamide?
The canonical SMILES for N-[2,3-dihydroxy-3-[5-(methoxymethyl)furan-2-yl]propyl]acetamide is COCc1ccc(C(O)C(O)CNC(C)=O)o1.
What is the InChIKey of N-[2,3-dihydroxy-3-[5-(methoxymethyl)furan-2-yl]propyl]acetamide?
The InChIKey is BPYINZQWQCNSOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO5/c1-7(13)12-5-9(14)11(15)10-4-3-8(17-10)6-16-2/h3-4,9,11,14-15H,5-6H2,1-2H3,(H,12,13).
What are the key properties of N-[2,3-dihydroxy-3-[5-(methoxymethyl)furan-2-yl]propyl]acetamide?
N-[2,3-dihydroxy-3-[5-(methoxymethyl)furan-2-yl]propyl]acetamide has a molecular weight of 243.26 g/mol, XLogP of -0.04, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,3-dihydroxy-3-[5-(methoxymethyl)furan-2-yl]propyl]acetamide is sourced from PubChem (CID 170831484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).