C18H23NO4S — CID 170832840
tert-butyl N-[2,3-dihydroxy-3-(5-phenylthiophen-2-yl)propyl]carbamate (PubChem CID 170832840) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is tert-butyl N-[2,3-dihydroxy-3-(5-phenylthiophen-2-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[2,3-dihydroxy-3-(5-phenylthiophen-2-yl)propyl]carbamate |
|---|---|
| PubChem CID | 170832840 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | tert-butyl N-[2,3-dihydroxy-3-(5-phenylthiophen-2-yl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1ccc(-c2ccccc2)s1 |
| InChI | InChI=1S/C18H23NO4S/c1-18(2,3)23-17(22)19-11-13(20)16(21)15-10-9-14(24-15)12-7-5-4-6-8-12/h4-10,13,16,20-21H,11H2,1-3H3,(H,19,22) |
| InChIKey | RNZWOIGJFLTHED-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |