About CID 170844432
CID 170844432 (PubChem CID 170844432) has the molecular formula C6H21InP
and a molecular weight of 239.03 g/mol.
Molecular Properties
| Compound Name | CID 170844432 |
| PubChem CID | 170844432 |
| Molecular Formula | C6H21InP |
| Molecular Weight | 239.03 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | — |
| SMILES | C.C.C.CP(C)C.[In] |
| InChI | InChI=1S/C3H9P.3CH4.In/c1-4(2)3;;;;/h1-3H3;3*1H4; |
| InChIKey | NHOOGEAYCNFJRW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.03 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 170844432 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170844432?
The IUPAC name of CID 170844432 (CID 170844432) is not available.
What is the SMILES notation for CID 170844432?
The canonical SMILES for CID 170844432 is C.C.C.CP(C)C.[In].
What is the InChIKey of CID 170844432?
The InChIKey is NHOOGEAYCNFJRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9P.3CH4.In/c1-4(2)3;;;;/h1-3H3;3*1H4;.
What are the key properties of CID 170844432?
CID 170844432 has a molecular weight of 239.03 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170844432 is sourced from PubChem (CID 170844432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).