About trichlorocobalt;trimethylphosphane
trichlorocobalt;trimethylphosphane (PubChem CID 174913274) has the molecular formula C3H9Cl3CoP
and a molecular weight of 241.37 g/mol. Its IUPAC name is trichlorocobalt;trimethylphosphane.
Molecular Properties
| Compound Name | trichlorocobalt;trimethylphosphane |
| PubChem CID | 174913274 |
| Molecular Formula | C3H9Cl3CoP |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 239.88 |
| IUPAC Name | trichlorocobalt;trimethylphosphane |
| SMILES | CP(C)C.Cl[Co](Cl)Cl |
| InChI | InChI=1S/C3H9P.3ClH.Co/c1-4(2)3;;;;/h1-3H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | PFIDSJQBHXVOGF-UHFFFAOYSA-K |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze trichlorocobalt;trimethylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichlorocobalt;trimethylphosphane?
The IUPAC name of trichlorocobalt;trimethylphosphane (CID 174913274) is trichlorocobalt;trimethylphosphane.
What is the SMILES notation for trichlorocobalt;trimethylphosphane?
The canonical SMILES for trichlorocobalt;trimethylphosphane is CP(C)C.Cl[Co](Cl)Cl.
What is the InChIKey of trichlorocobalt;trimethylphosphane?
The InChIKey is PFIDSJQBHXVOGF-UHFFFAOYSA-K. The full InChI is InChI=1S/C3H9P.3ClH.Co/c1-4(2)3;;;;/h1-3H3;3*1H;/q;;;;+3/p-3.
What are the key properties of trichlorocobalt;trimethylphosphane?
trichlorocobalt;trimethylphosphane has a molecular weight of 241.37 g/mol, XLogP of 3.42, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trichlorocobalt;trimethylphosphane is sourced from PubChem (CID 174913274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).