C38H47Cl3N4O4 — CID 170847949
3-(3-octadec-9-enyl-2,5-dioxopyrrolidin-1-yl)-N-[5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]benzamide (PubChem CID 170847949) has the molecular formula C38H47Cl3N4O4 and a molecular weight of 730.18 g/mol. Its IUPAC name is 3-(3-octadec-9-enyl-2,5-dioxopyrrolidin-1-yl)-N-[5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]benzamide.
| Compound Name | 3-(3-octadec-9-enyl-2,5-dioxopyrrolidin-1-yl)-N-[5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 170847949 |
| Molecular Formula | C38H47Cl3N4O4 |
| Molecular Weight | 730.18 g/mol |
| Exact Mass | 728.27 |
| IUPAC Name | 3-(3-octadec-9-enyl-2,5-dioxopyrrolidin-1-yl)-N-[5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]benzamide |
| SMILES | CCCCCCCCC=CCCCCCCCCC1CC(=O)N(c2cccc(C(=O)NC3=NN(c4c(Cl)cc(Cl)cc4Cl)C(=O)C3)c2)C1=O |
| InChI | InChI=1S/C38H47Cl3N4O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-28-23-34(46)44(38(28)49)30-21-18-20-27(22-30)37(48)42-33-26-35(47)45(43-33)36-31(40)24-29(39)25-32(36)41/h9-10,18,20-22,24-25,28H,2-8,11-17,19,23,26H2,1H3,(H,42,43,48) |
| InChIKey | BXGJGJQVGKRWJG-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.18 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|