C28H48N4O6Si2 — CID 170851342
tert-butyl (6aR,8R,9aS)-8-(4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-[1,3,5,2,4]trioxadisilocino[7,6-b]pyrrole-7-carboxylate (PubChem CID 170851342) has the molecular formula C28H48N4O6Si2 and a molecular weight of 592.89 g/mol. Its IUPAC name is tert-butyl (6aR,8R,9aS)-8-(4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-[1,3,5,2,4]trioxadisilocino[7,6-b]pyrrole-7-carboxylate.
| Compound Name | tert-butyl (6aR,8R,9aS)-8-(4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-[1,3,5,2,4]trioxadisilocino[7,6-b]pyrrole-7-carboxylate |
|---|---|
| PubChem CID | 170851342 |
| Molecular Formula | C28H48N4O6Si2 |
| Molecular Weight | 592.89 g/mol |
| Exact Mass | 592.31 |
| IUPAC Name | tert-butyl (6aR,8R,9aS)-8-(4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-[1,3,5,2,4]trioxadisilocino[7,6-b]pyrrole-7-carboxylate |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@@H]2[C@H](C[C@H](c3c[nH]c4c(=O)[nH]cnc34)N2C(=O)OC(C)(C)C)O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C28H48N4O6Si2/c1-16(2)39(17(3)4)35-14-22-23(37-40(38-39,18(5)6)19(7)8)12-21(32(22)27(34)36-28(9,10)11)20-13-29-25-24(20)30-15-31-26(25)33/h13,15-19,21-23,29H,12,14H2,1-11H3,(H,30,31,33)/t21-,22-,23+/m1/s1 |
| InChIKey | HEEZMPYRTSVFHT-ZLNRFVROSA-N |
| XLogP | 6.26 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.89 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|