C21H32F3N4O11PS — CID 136597625
tert-butyl (2R,3R,4S,5R)-3,4-dihydroxy-2-(hydroxymethyl)-5-(4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)pyrrolidine-1-carboxylate;[ethoxy(methyl)phosphoryl]methyl trifluoromethanesulfonate (PubChem CID 136597625) has the molecular formula C21H32F3N4O11PS and a molecular weight of 636.54 g/mol. Its IUPAC name is tert-butyl (2R,3R,4S,5R)-3,4-dihydroxy-2-(hydroxymethyl)-5-(4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)pyrrolidine-1-carboxylate;[ethoxy(methyl)phosphoryl]methyl trifluoromethanesulfonate.
| Compound Name | tert-butyl (2R,3R,4S,5R)-3,4-dihydroxy-2-(hydroxymethyl)-5-(4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)pyrrolidine-1-carboxylate;[ethoxy(methyl)phosphoryl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 136597625 |
| Molecular Formula | C21H32F3N4O11PS |
| Molecular Weight | 636.54 g/mol |
| Exact Mass | 636.15 |
| IUPAC Name | tert-butyl (2R,3R,4S,5R)-3,4-dihydroxy-2-(hydroxymethyl)-5-(4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)pyrrolidine-1-carboxylate;[ethoxy(methyl)phosphoryl]methyl trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CO)[C@@H](O)[C@@H](O)[C@H]1c1c[nH]c2c(=O)[nH]cnc12.CCOP(C)(=O)COS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H22N4O6.C5H10F3O5PS/c1-16(2,3)26-15(25)20-8(5-21)12(22)13(23)11(20)7-4-17-10-9(7)18-6-19-14(10)24;1-3-12-14(2,9)4-13-15(10,11)5(6,7)8/h4,6,8,11-13,17,21-23H,5H2,1-3H3,(H,18,19,24);3-4H2,1-2H3/t8-,11-,12-,13+;/m1./s1 |
| InChIKey | VCKAURSAPSOHAS-MRFBDGFPSA-N |
| XLogP | 1.38 |
| TPSA | 221.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.54 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|