C18H25NO5 — CID 170851358
(1R,2R,3S,4R,5R)-3-(benzylamino)-2-[(2S)-oxan-2-yl]oxy-6,8-dioxabicyclo[3.2.1]octan-4-ol (PubChem CID 170851358) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is (1R,2R,3S,4R,5R)-3-(benzylamino)-2-[(2S)-oxan-2-yl]oxy-6,8-dioxabicyclo[3.2.1]octan-4-ol.
| Compound Name | (1R,2R,3S,4R,5R)-3-(benzylamino)-2-[(2S)-oxan-2-yl]oxy-6,8-dioxabicyclo[3.2.1]octan-4-ol |
|---|---|
| PubChem CID | 170851358 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (1R,2R,3S,4R,5R)-3-(benzylamino)-2-[(2S)-oxan-2-yl]oxy-6,8-dioxabicyclo[3.2.1]octan-4-ol |
| SMILES | O[C@H]1[C@@H]2OC[C@@H](O2)[C@H](O[C@H]2CCCCO2)[C@H]1NCc1ccccc1 |
| InChI | InChI=1S/C18H25NO5/c20-16-15(19-10-12-6-2-1-3-7-12)17(13-11-22-18(16)23-13)24-14-8-4-5-9-21-14/h1-3,6-7,13-20H,4-5,8-11H2/t13-,14+,15+,16-,17+,18-/m1/s1 |
| InChIKey | NTLBSYZZZDLOSI-CMURFVSUSA-N |
| XLogP | 1.17 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |