C28H22N4O6 — CID 170852034
benzene-1,3-diamine;benzene-1,4-diamine;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione (PubChem CID 170852034) has the molecular formula C28H22N4O6 and a molecular weight of 510.51 g/mol. Its IUPAC name is benzene-1,3-diamine;benzene-1,4-diamine;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione.
| Compound Name | benzene-1,3-diamine;benzene-1,4-diamine;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 170852034 |
| Molecular Formula | C28H22N4O6 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | benzene-1,3-diamine;benzene-1,4-diamine;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione |
| SMILES | Nc1ccc(N)cc1.Nc1cccc(N)c1.O=C1OC(=O)c2cc(-c3ccc4c(c3)C(=O)OC4=O)ccc21 |
| InChI | InChI=1S/C16H6O6.2C6H8N2/c17-13-9-3-1-7(5-11(9)15(19)21-13)8-2-4-10-12(6-8)16(20)22-14(10)18;7-5-1-2-6(8)4-3-5;7-5-2-1-3-6(8)4-5/h1-6H;2*1-4H,7-8H2 |
| InChIKey | OJTOUGGKZYULGR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 190.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|