C15H32O3 — CID 170852286
2-ethyloxirane;oxirane;3,5,5-trimethylhexan-1-ol (PubChem CID 170852286) has the molecular formula C15H32O3 and a molecular weight of 260.42 g/mol. Its IUPAC name is 2-ethyloxirane;oxirane;3,5,5-trimethylhexan-1-ol.
| Compound Name | 2-ethyloxirane;oxirane;3,5,5-trimethylhexan-1-ol |
|---|---|
| PubChem CID | 170852286 |
| Molecular Formula | C15H32O3 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.24 |
| IUPAC Name | 2-ethyloxirane;oxirane;3,5,5-trimethylhexan-1-ol |
| SMILES | C1CO1.CC(CCO)CC(C)(C)C.CCC1CO1 |
| InChI | InChI=1S/C9H20O.C4H8O.C2H4O/c1-8(5-6-10)7-9(2,3)4;1-2-4-3-5-4;1-2-3-1/h8,10H,5-7H2,1-4H3;4H,2-3H2,1H3;1-2H2 |
| InChIKey | AQGZSUYXWKEBAR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 45.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|