C10H9NO5 — CID 170871582
(3Z)-3-(1,3-benzodioxol-5-yl)-3-hydroxyiminopropanoic acid (PubChem CID 170871582) has the molecular formula C10H9NO5 and a molecular weight of 223.18 g/mol. Its IUPAC name is (3Z)-3-(1,3-benzodioxol-5-yl)-3-hydroxyiminopropanoic acid.
| Compound Name | (3Z)-3-(1,3-benzodioxol-5-yl)-3-hydroxyiminopropanoic acid |
|---|---|
| PubChem CID | 170871582 |
| Molecular Formula | C10H9NO5 |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | (3Z)-3-(1,3-benzodioxol-5-yl)-3-hydroxyiminopropanoic acid |
| SMILES | O=C(O)C/C(=N/O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H9NO5/c12-10(13)4-7(11-14)6-1-2-8-9(3-6)16-5-15-8/h1-3,14H,4-5H2,(H,12,13)/b11-7- |
| InChIKey | OXRGACCDKCHPBI-XFFZJAGNSA-N |
| XLogP | 1.07 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|