C9H10N2O3 — CID 53397824
N-[2-amino-1-(1,3-benzodioxol-5-yl)ethylidene]hydroxylamine (PubChem CID 53397824) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is N-[2-amino-1-(1,3-benzodioxol-5-yl)ethylidene]hydroxylamine.
| Compound Name | N-[2-amino-1-(1,3-benzodioxol-5-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 53397824 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | N-[2-amino-1-(1,3-benzodioxol-5-yl)ethylidene]hydroxylamine |
| SMILES | NCC(=NO)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H10N2O3/c10-4-7(11-12)6-1-2-8-9(3-6)14-5-13-8/h1-3,12H,4-5,10H2 |
| InChIKey | KVUKFJRNPHKYHF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|