C8H10N4O2 — CID 144611509
N'-hydrazinyl-1,3-benzodioxole-5-carboximidamide (PubChem CID 144611509) has the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. Its IUPAC name is N'-hydrazinyl-1,3-benzodioxole-5-carboximidamide.
| Compound Name | N'-hydrazinyl-1,3-benzodioxole-5-carboximidamide |
|---|---|
| PubChem CID | 144611509 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | N'-hydrazinyl-1,3-benzodioxole-5-carboximidamide |
| SMILES | NN/N=C(\N)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C8H10N4O2/c9-8(11-12-10)5-1-2-6-7(3-5)14-4-13-6/h1-3,12H,4,10H2,(H2,9,11) |
| InChIKey | SMHRDFRBGSYNEM-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|