C15H11BrN2O4 — CID 2977043
[[amino-(3-bromophenyl)methylidene]amino] 1,3-benzodioxole-5-carboxylate (PubChem CID 2977043) has the molecular formula C15H11BrN2O4 and a molecular weight of 363.17 g/mol. Its IUPAC name is [[amino-(3-bromophenyl)methylidene]amino] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [[amino-(3-bromophenyl)methylidene]amino] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 2977043 |
| Molecular Formula | C15H11BrN2O4 |
| Molecular Weight | 363.17 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | [[amino-(3-bromophenyl)methylidene]amino] 1,3-benzodioxole-5-carboxylate |
| SMILES | NC(=NOC(=O)c1ccc2c(c1)OCO2)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H11BrN2O4/c16-11-3-1-2-9(6-11)14(17)18-22-15(19)10-4-5-12-13(7-10)21-8-20-12/h1-7H,8H2,(H2,17,18) |
| InChIKey | DFDNENYNQFSLEZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.17 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|