C11H10N5O5+ — CID 135478622
[[amino-(4-amino-1,2,5-oxadiazol-5-ium-3-yl)methylidene]amino] 1,3-benzodioxole-5-carboxylate (PubChem CID 135478622) has the molecular formula C11H10N5O5+ and a molecular weight of 292.23 g/mol. Its IUPAC name is [[amino-(4-amino-1,2,5-oxadiazol-5-ium-3-yl)methylidene]amino] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [[amino-(4-amino-1,2,5-oxadiazol-5-ium-3-yl)methylidene]amino] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 135478622 |
| Molecular Formula | C11H10N5O5+ |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | [[amino-(4-amino-1,2,5-oxadiazol-5-ium-3-yl)methylidene]amino] 1,3-benzodioxole-5-carboxylate |
| SMILES | NC(=NOC(=O)c1ccc2c(c1)OCO2)c1no[nH+]c1N |
| InChI | InChI=1S/C11H9N5O5/c12-9(8-10(13)16-21-14-8)15-20-11(17)5-1-2-6-7(3-5)19-4-18-6/h1-3H,4H2,(H2,12,15)(H2,13,16)/p+1 |
| InChIKey | MCRIOQHUONJNBV-UHFFFAOYSA-O |
| XLogP | -0.72 |
| TPSA | 149.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|