About 1,6-diamino-3,5-bis(aminomethyl)-4-thiophen-2-ylpyridin-2-one
1,6-diamino-3,5-bis(aminomethyl)-4-thiophen-2-ylpyridin-2-one (PubChem CID 170875480) has the molecular formula C11H15N5OS
and a molecular weight of 265.34 g/mol. Its IUPAC name is 1,6-diamino-3,5-bis(aminomethyl)-4-thiophen-2-ylpyridin-2-one.
Molecular Properties
| Compound Name | 1,6-diamino-3,5-bis(aminomethyl)-4-thiophen-2-ylpyridin-2-one |
| PubChem CID | 170875480 |
| Molecular Formula | C11H15N5OS |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 1,6-diamino-3,5-bis(aminomethyl)-4-thiophen-2-ylpyridin-2-one |
| SMILES | NCc1c(-c2cccs2)c(CN)c(=O)n(N)c1N |
| InChI | InChI=1S/C11H15N5OS/c12-4-6-9(8-2-1-3-18-8)7(5-13)11(17)16(15)10(6)14/h1-3H,4-5,12-15H2 |
| InChIKey | SGDILENAWIEYGG-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 126.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1,6-diamino-3,5-bis(aminomethyl)-4-thiophen-2-ylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-diamino-3,5-bis(aminomethyl)-4-thiophen-2-ylpyridin-2-one?
The IUPAC name of 1,6-diamino-3,5-bis(aminomethyl)-4-thiophen-2-ylpyridin-2-one (CID 170875480) is 1,6-diamino-3,5-bis(aminomethyl)-4-thiophen-2-ylpyridin-2-one.
What is the SMILES notation for 1,6-diamino-3,5-bis(aminomethyl)-4-thiophen-2-ylpyridin-2-one?
The canonical SMILES for 1,6-diamino-3,5-bis(aminomethyl)-4-thiophen-2-ylpyridin-2-one is NCc1c(-c2cccs2)c(CN)c(=O)n(N)c1N.
What is the InChIKey of 1,6-diamino-3,5-bis(aminomethyl)-4-thiophen-2-ylpyridin-2-one?
The InChIKey is SGDILENAWIEYGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5OS/c12-4-6-9(8-2-1-3-18-8)7(5-13)11(17)16(15)10(6)14/h1-3H,4-5,12-15H2.
What are the key properties of 1,6-diamino-3,5-bis(aminomethyl)-4-thiophen-2-ylpyridin-2-one?
1,6-diamino-3,5-bis(aminomethyl)-4-thiophen-2-ylpyridin-2-one has a molecular weight of 265.34 g/mol, XLogP of -0.21, 3 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-diamino-3,5-bis(aminomethyl)-4-thiophen-2-ylpyridin-2-one is sourced from PubChem (CID 170875480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).