C10H8ClF2NO — CID 170886238
2-[2-(2-chloroethoxy)-3,5-difluorophenyl]acetonitrile (PubChem CID 170886238) has the molecular formula C10H8ClF2NO and a molecular weight of 231.63 g/mol. Its IUPAC name is 2-[2-(2-chloroethoxy)-3,5-difluorophenyl]acetonitrile.
| Compound Name | 2-[2-(2-chloroethoxy)-3,5-difluorophenyl]acetonitrile |
|---|---|
| PubChem CID | 170886238 |
| Molecular Formula | C10H8ClF2NO |
| Molecular Weight | 231.63 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 2-[2-(2-chloroethoxy)-3,5-difluorophenyl]acetonitrile |
| SMILES | N#CCc1cc(F)cc(F)c1OCCCl |
| InChI | InChI=1S/C10H8ClF2NO/c11-2-4-15-10-7(1-3-14)5-8(12)6-9(10)13/h5-6H,1-2,4H2 |
| InChIKey | SKKHUYAXYOBZTK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.63 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|