C16H17NS3 — CID 170888631
1-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]butan-2-amine (PubChem CID 170888631) has the molecular formula C16H17NS3 and a molecular weight of 319.52 g/mol. Its IUPAC name is 1-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]butan-2-amine.
| Compound Name | 1-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]butan-2-amine |
|---|---|
| PubChem CID | 170888631 |
| Molecular Formula | C16H17NS3 |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 1-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]butan-2-amine |
| SMILES | CCC(N)Cc1ccc(-c2ccc(-c3cccs3)s2)s1 |
| InChI | InChI=1S/C16H17NS3/c1-2-11(17)10-12-5-6-15(19-12)16-8-7-14(20-16)13-4-3-9-18-13/h3-9,11H,2,10,17H2,1H3 |
| InChIKey | HCPALUFCRWYPJM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |