C11H15N3O — CID 170895159
1-(7-methoxy-1H-indol-2-yl)ethane-1,2-diamine (PubChem CID 170895159) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-(7-methoxy-1H-indol-2-yl)ethane-1,2-diamine.
| Compound Name | 1-(7-methoxy-1H-indol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 170895159 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 1-(7-methoxy-1H-indol-2-yl)ethane-1,2-diamine |
| SMILES | COc1cccc2cc(C(N)CN)[nH]c12 |
| InChI | InChI=1S/C11H15N3O/c1-15-10-4-2-3-7-5-9(8(13)6-12)14-11(7)10/h2-5,8,14H,6,12-13H2,1H3 |
| InChIKey | BFDXTHZEEYOJGK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 77.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |