C38H32NOP — CID 170897578
diphenyl-[1-[3-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]naphthalen-1-yl]naphthalen-2-yl]phosphane (PubChem CID 170897578) has the molecular formula C38H32NOP and a molecular weight of 549.65 g/mol. Its IUPAC name is diphenyl-[1-[3-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]naphthalen-1-yl]naphthalen-2-yl]phosphane.
| Compound Name | diphenyl-[1-[3-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]naphthalen-1-yl]naphthalen-2-yl]phosphane |
|---|---|
| PubChem CID | 170897578 |
| Molecular Formula | C38H32NOP |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | diphenyl-[1-[3-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]naphthalen-1-yl]naphthalen-2-yl]phosphane |
| SMILES | CC(C)[C@H]1COC(c2cc(-c3c(P(c4ccccc4)c4ccccc4)ccc4ccccc34)c3ccccc3c2)=N1 |
| InChI | InChI=1S/C38H32NOP/c1-26(2)35-25-40-38(39-35)29-23-28-14-10-11-19-32(28)34(24-29)37-33-20-12-9-13-27(33)21-22-36(37)41(30-15-5-3-6-16-30)31-17-7-4-8-18-31/h3-24,26,35H,25H2,1-2H3/t35-/m1/s1 |
| InChIKey | JZGPXEGMJMDHLC-PGUFJCEWSA-N |
| XLogP | 8.22 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|