C28H29N2O2P — CID 102053559
[1-(methoxymethyl)-3-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]indol-2-yl]-diphenylphosphane (PubChem CID 102053559) has the molecular formula C28H29N2O2P and a molecular weight of 456.53 g/mol. Its IUPAC name is [1-(methoxymethyl)-3-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]indol-2-yl]-diphenylphosphane.
| Compound Name | [1-(methoxymethyl)-3-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]indol-2-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 102053559 |
| Molecular Formula | C28H29N2O2P |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | [1-(methoxymethyl)-3-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]indol-2-yl]-diphenylphosphane |
| SMILES | COCn1c(P(c2ccccc2)c2ccccc2)c(C2=N[C@H](C(C)C)CO2)c2ccccc21 |
| InChI | InChI=1S/C28H29N2O2P/c1-20(2)24-18-32-27(29-24)26-23-16-10-11-17-25(23)30(19-31-3)28(26)33(21-12-6-4-7-13-21)22-14-8-5-9-15-22/h4-17,20,24H,18-19H2,1-3H3/t24-/m0/s1 |
| InChIKey | NABWWEGBSODEIJ-DEOSSOPVSA-N |
| XLogP | 4.80 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|