C14H25BO3 — CID 170903232
2-[(E)-(2,2-dimethyloxan-4-ylidene)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 170903232) has the molecular formula C14H25BO3 and a molecular weight of 252.16 g/mol. Its IUPAC name is 2-[(E)-(2,2-dimethyloxan-4-ylidene)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(E)-(2,2-dimethyloxan-4-ylidene)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 170903232 |
| Molecular Formula | C14H25BO3 |
| Molecular Weight | 252.16 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 2-[(E)-(2,2-dimethyloxan-4-ylidene)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)C/C(=C/B2OC(C)(C)C(C)(C)O2)CCO1 |
| InChI | InChI=1S/C14H25BO3/c1-12(2)9-11(7-8-16-12)10-15-17-13(3,4)14(5,6)18-15/h10H,7-9H2,1-6H3/b11-10+ |
| InChIKey | IOAYOFJKJMNJCT-ZHACJKMWSA-N |
| XLogP | 3.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.16 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|