C10H16ClNO — CID 170905473
5-chloro-3-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbaldehyde (PubChem CID 170905473) has the molecular formula C10H16ClNO and a molecular weight of 201.70 g/mol. Its IUPAC name is 5-chloro-3-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbaldehyde.
| Compound Name | 5-chloro-3-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbaldehyde |
|---|---|
| PubChem CID | 170905473 |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 5-chloro-3-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbaldehyde |
| SMILES | CC1C(C=O)NC2CCC(Cl)CC21 |
| InChI | InChI=1S/C10H16ClNO/c1-6-8-4-7(11)2-3-9(8)12-10(6)5-13/h5-10,12H,2-4H2,1H3 |
| InChIKey | KOTANNXMGAPDLQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|