C14H23ClN2S — CID 170905957
1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-4-yl)-N-(thiophen-2-ylmethyl)methanamine;hydrochloride (PubChem CID 170905957) has the molecular formula C14H23ClN2S and a molecular weight of 286.87 g/mol. Its IUPAC name is 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-4-yl)-N-(thiophen-2-ylmethyl)methanamine;hydrochloride.
| Compound Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-4-yl)-N-(thiophen-2-ylmethyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 170905957 |
| Molecular Formula | C14H23ClN2S |
| Molecular Weight | 286.87 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-4-yl)-N-(thiophen-2-ylmethyl)methanamine;hydrochloride |
| SMILES | Cl.c1csc(CNCC2CCCC3NCCC23)c1 |
| InChI | InChI=1S/C14H22N2S.ClH/c1-3-11(13-6-7-16-14(13)5-1)9-15-10-12-4-2-8-17-12;/h2,4,8,11,13-16H,1,3,5-7,9-10H2;1H |
| InChIKey | GRUYOGBAHQWDOA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.87 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |