C16H11Cl2NO3 — CID 170913910
2-[(2,4-dichlorophenyl)methoxy]-1-hydroxyisoquinolin-3-one (PubChem CID 170913910) has the molecular formula C16H11Cl2NO3 and a molecular weight of 336.17 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methoxy]-1-hydroxyisoquinolin-3-one.
| Compound Name | 2-[(2,4-dichlorophenyl)methoxy]-1-hydroxyisoquinolin-3-one |
|---|---|
| PubChem CID | 170913910 |
| Molecular Formula | C16H11Cl2NO3 |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methoxy]-1-hydroxyisoquinolin-3-one |
| SMILES | O=c1cc2ccccc2c(O)n1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H11Cl2NO3/c17-12-6-5-11(14(18)8-12)9-22-19-15(20)7-10-3-1-2-4-13(10)16(19)21/h1-8,21H,9H2 |
| InChIKey | HSINQANDUFRXOZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |