C29H34N2O2 — CID 170919299
N-hexyl-N'-methyl-2-[(E)-2-naphthalen-2-ylprop-1-enyl]-N'-phenylpropanediamide (PubChem CID 170919299) has the molecular formula C29H34N2O2 and a molecular weight of 442.60 g/mol. Its IUPAC name is N-hexyl-N'-methyl-2-[(E)-2-naphthalen-2-ylprop-1-enyl]-N'-phenylpropanediamide.
| Compound Name | N-hexyl-N'-methyl-2-[(E)-2-naphthalen-2-ylprop-1-enyl]-N'-phenylpropanediamide |
|---|---|
| PubChem CID | 170919299 |
| Molecular Formula | C29H34N2O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | N-hexyl-N'-methyl-2-[(E)-2-naphthalen-2-ylprop-1-enyl]-N'-phenylpropanediamide |
| SMILES | CCCCCCNC(=O)C(/C=C(\C)c1ccc2ccccc2c1)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C29H34N2O2/c1-4-5-6-12-19-30-28(32)27(29(33)31(3)26-15-8-7-9-16-26)20-22(2)24-18-17-23-13-10-11-14-25(23)21-24/h7-11,13-18,20-21,27H,4-6,12,19H2,1-3H3,(H,30,32)/b22-20+ |
| InChIKey | QPXZLGKMTZFNJV-LSDHQDQOSA-N |
| XLogP | 6.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|