C22H29ClNO5+ — CID 170922381
2-[2-(4-chlorobenzoyl)phenoxy]-2-methylpropanoic acid;2-hydroxyethyl(trimethyl)azanium (PubChem CID 170922381) has the molecular formula C22H29ClNO5+ and a molecular weight of 422.93 g/mol. Its IUPAC name is 2-[2-(4-chlorobenzoyl)phenoxy]-2-methylpropanoic acid;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | 2-[2-(4-chlorobenzoyl)phenoxy]-2-methylpropanoic acid;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 170922381 |
| Molecular Formula | C22H29ClNO5+ |
| Molecular Weight | 422.93 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2-[2-(4-chlorobenzoyl)phenoxy]-2-methylpropanoic acid;2-hydroxyethyl(trimethyl)azanium |
| SMILES | CC(C)(Oc1ccccc1C(=O)c1ccc(Cl)cc1)C(=O)O.C[N+](C)(C)CCO |
| InChI | InChI=1S/C17H15ClO4.C5H14NO/c1-17(2,16(20)21)22-14-6-4-3-5-13(14)15(19)11-7-9-12(18)10-8-11;1-6(2,3)4-5-7/h3-10H,1-2H3,(H,20,21);7H,4-5H2,1-3H3/q;+1 |
| InChIKey | NDVCPHPCCOMZCE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.93 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|