C6H7O7- — CID 170925301
3-carboxy-4-hydroperoxy-3-hydroxypent-4-enoate (PubChem CID 170925301) has the molecular formula C6H7O7- and a molecular weight of 191.11 g/mol. Its IUPAC name is 3-carboxy-4-hydroperoxy-3-hydroxypent-4-enoate.
| Compound Name | 3-carboxy-4-hydroperoxy-3-hydroxypent-4-enoate |
|---|---|
| PubChem CID | 170925301 |
| Molecular Formula | C6H7O7- |
| Molecular Weight | 191.11 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | 3-carboxy-4-hydroperoxy-3-hydroxypent-4-enoate |
| SMILES | C=C(OO)C(O)(CC(=O)[O-])C(=O)O |
| InChI | InChI=1S/C6H8O7/c1-3(13-12)6(11,5(9)10)2-4(7)8/h11-12H,1-2H2,(H,7,8)(H,9,10)/p-1 |
| InChIKey | IEQXPZPRHJRRMQ-UHFFFAOYSA-M |
| XLogP | -2.05 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.11 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|