C22H48N6O7 — CID 157275994
2-(1-hydroperoxyethenyl)-2-hydroxybutanedioic acid;N,N,N',N'-tetrakis(3-aminopropyl)butane-1,4-diamine (PubChem CID 157275994) has the molecular formula C22H48N6O7 and a molecular weight of 508.66 g/mol. Its IUPAC name is 2-(1-hydroperoxyethenyl)-2-hydroxybutanedioic acid;N,N,N',N'-tetrakis(3-aminopropyl)butane-1,4-diamine.
| Compound Name | 2-(1-hydroperoxyethenyl)-2-hydroxybutanedioic acid;N,N,N',N'-tetrakis(3-aminopropyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 157275994 |
| Molecular Formula | C22H48N6O7 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.36 |
| IUPAC Name | 2-(1-hydroperoxyethenyl)-2-hydroxybutanedioic acid;N,N,N',N'-tetrakis(3-aminopropyl)butane-1,4-diamine |
| SMILES | C=C(OO)C(O)(CC(=O)O)C(=O)O.NCCCN(CCCN)CCCCN(CCCN)CCCN |
| InChI | InChI=1S/C16H40N6.C6H8O7/c17-7-3-13-21(14-4-8-18)11-1-2-12-22(15-5-9-19)16-6-10-20;1-3(13-12)6(11,5(9)10)2-4(7)8/h1-20H2;11-12H,1-2H2,(H,7,8)(H,9,10) |
| InChIKey | AZCLNCSRWMWOMJ-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 234.85 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|