C33H54N6O3 — CID 170936138
(2S)-5-(diaminomethylideneamino)-N-[3-(diethylamino)propyl]-2-[[2-[4-[(1E,3R)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenoxy]acetyl]amino]pentanamide (PubChem CID 170936138) has the molecular formula C33H54N6O3 and a molecular weight of 582.83 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-N-[3-(diethylamino)propyl]-2-[[2-[4-[(1E,3R)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenoxy]acetyl]amino]pentanamide.
| Compound Name | (2S)-5-(diaminomethylideneamino)-N-[3-(diethylamino)propyl]-2-[[2-[4-[(1E,3R)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenoxy]acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 170936138 |
| Molecular Formula | C33H54N6O3 |
| Molecular Weight | 582.83 g/mol |
| Exact Mass | 582.43 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-N-[3-(diethylamino)propyl]-2-[[2-[4-[(1E,3R)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenoxy]acetyl]amino]pentanamide |
| SMILES | C=C[C@](C)(/C=C/c1ccc(OCC(=O)N[C@@H](CCCN=C(N)N)C(=O)NCCCN(CC)CC)cc1)CCC=C(C)C |
| InChI | InChI=1S/C33H54N6O3/c1-7-33(6,20-10-13-26(4)5)21-19-27-15-17-28(18-16-27)42-25-30(40)38-29(14-11-22-37-32(34)35)31(41)36-23-12-24-39(8-2)9-3/h7,13,15-19,21,29H,1,8-12,14,20,22-25H2,2-6H3,(H,36,41)(H,38,40)(H4,34,35,37)/b21-19+/t29-,33-/m0/s1 |
| InChIKey | FKSOUIHFJNSTTG-OHMNTWMHSA-N |
| XLogP | 4.40 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.83 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|