C30H33N2O2Si+ — CID 170936974
3-methyl-4-(1,10,10-trimethyl-8-pyrrolidin-1-yl-2,3-dihydro-[1]benzosilino[3,2-f]indol-1-ium-5-yl)benzoic acid (PubChem CID 170936974) has the molecular formula C30H33N2O2Si+ and a molecular weight of 481.69 g/mol. Its IUPAC name is 3-methyl-4-(1,10,10-trimethyl-8-pyrrolidin-1-yl-2,3-dihydro-[1]benzosilino[3,2-f]indol-1-ium-5-yl)benzoic acid.
| Compound Name | 3-methyl-4-(1,10,10-trimethyl-8-pyrrolidin-1-yl-2,3-dihydro-[1]benzosilino[3,2-f]indol-1-ium-5-yl)benzoic acid |
|---|---|
| PubChem CID | 170936974 |
| Molecular Formula | C30H33N2O2Si+ |
| Molecular Weight | 481.69 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 3-methyl-4-(1,10,10-trimethyl-8-pyrrolidin-1-yl-2,3-dihydro-[1]benzosilino[3,2-f]indol-1-ium-5-yl)benzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1C1=c2cc3c(cc2[Si](C)(C)c2cc(N4CCCC4)ccc21)=[N+](C)CC3 |
| InChI | InChI=1S/C30H32N2O2Si/c1-19-15-21(30(33)34)7-9-23(19)29-24-10-8-22(32-12-5-6-13-32)17-27(24)35(3,4)28-18-26-20(16-25(28)29)11-14-31(26)2/h7-10,15-18H,5-6,11-14H2,1-4H3/p+1 |
| InChIKey | DPNDOPTZMVCAJK-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.69 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|