C25H33ClN2O4S — CID 17093847
decyl 2-[1-(3-chloro-1-benzothiophene-2-carbonyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 17093847) has the molecular formula C25H33ClN2O4S and a molecular weight of 493.07 g/mol. Its IUPAC name is decyl 2-[1-(3-chloro-1-benzothiophene-2-carbonyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | decyl 2-[1-(3-chloro-1-benzothiophene-2-carbonyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17093847 |
| Molecular Formula | C25H33ClN2O4S |
| Molecular Weight | 493.07 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | decyl 2-[1-(3-chloro-1-benzothiophene-2-carbonyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1C(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C25H33ClN2O4S/c1-2-3-4-5-6-7-8-11-16-32-21(29)17-19-24(30)27-14-15-28(19)25(31)23-22(26)18-12-9-10-13-20(18)33-23/h9-10,12-13,19H,2-8,11,14-17H2,1H3,(H,27,30) |
| InChIKey | HPCPDEWYBUDFTF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.07 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|