C6H3Br3O2 — CID 17094
2,4,6-tribromobenzene-1,3-diol (PubChem CID 17094) has the molecular formula C6H3Br3O2 and a molecular weight of 346.80 g/mol. Its IUPAC name is 2,4,6-tribromobenzene-1,3-diol.
| Compound Name | 2,4,6-tribromobenzene-1,3-diol |
|---|---|
| PubChem CID | 17094 |
| Molecular Formula | C6H3Br3O2 |
| Molecular Weight | 346.80 g/mol |
| Exact Mass | 343.77 |
| IUPAC Name | 2,4,6-tribromobenzene-1,3-diol |
| SMILES | Oc1c(Br)cc(Br)c(O)c1Br |
| InChI | InChI=1S/C6H3Br3O2/c7-2-1-3(8)6(11)4(9)5(2)10/h1,10-11H |
| InChIKey | YADZSMVDNYXOOB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.80 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |