C10H10FN3 — CID 170942601
6-fluoro-2,3-dimethyl-1,5-naphthyridin-4-amine (PubChem CID 170942601) has the molecular formula C10H10FN3 and a molecular weight of 191.21 g/mol. Its IUPAC name is 6-fluoro-2,3-dimethyl-1,5-naphthyridin-4-amine.
| Compound Name | 6-fluoro-2,3-dimethyl-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 170942601 |
| Molecular Formula | C10H10FN3 |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 6-fluoro-2,3-dimethyl-1,5-naphthyridin-4-amine |
| SMILES | Cc1nc2ccc(F)nc2c(N)c1C |
| InChI | InChI=1S/C10H10FN3/c1-5-6(2)13-7-3-4-8(11)14-10(7)9(5)12/h3-4H,1-2H3,(H2,12,13) |
| InChIKey | HVXBBIJUXBGXDQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|