C11H11FN2 — CID 159261241
5-fluoro-2,3,6-trimethylquinoxaline (PubChem CID 159261241) has the molecular formula C11H11FN2 and a molecular weight of 190.22 g/mol. Its IUPAC name is 5-fluoro-2,3,6-trimethylquinoxaline.
| Compound Name | 5-fluoro-2,3,6-trimethylquinoxaline |
|---|---|
| PubChem CID | 159261241 |
| Molecular Formula | C11H11FN2 |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 5-fluoro-2,3,6-trimethylquinoxaline |
| SMILES | Cc1ccc2nc(C)c(C)nc2c1F |
| InChI | InChI=1S/C11H11FN2/c1-6-4-5-9-11(10(6)12)14-8(3)7(2)13-9/h4-5H,1-3H3 |
| InChIKey | KWNNLHGAEONBMM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |