C31H38F3N5O5S — CID 170945415
[2-[[2-amino-6-[[(2Z)-2-piperidin-2-ylidene-1,3-oxazol-3-yl]methyl]phenyl]carbamoylsulfanylamino]-2-[3-(trifluoromethoxy)phenyl]propyl] 2,2-dimethylpropanoate (PubChem CID 170945415) has the molecular formula C31H38F3N5O5S and a molecular weight of 649.74 g/mol. Its IUPAC name is [2-[[2-amino-6-[[(2Z)-2-piperidin-2-ylidene-1,3-oxazol-3-yl]methyl]phenyl]carbamoylsulfanylamino]-2-[3-(trifluoromethoxy)phenyl]propyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[[2-amino-6-[[(2Z)-2-piperidin-2-ylidene-1,3-oxazol-3-yl]methyl]phenyl]carbamoylsulfanylamino]-2-[3-(trifluoromethoxy)phenyl]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 170945415 |
| Molecular Formula | C31H38F3N5O5S |
| Molecular Weight | 649.74 g/mol |
| Exact Mass | 649.25 |
| IUPAC Name | [2-[[2-amino-6-[[(2Z)-2-piperidin-2-ylidene-1,3-oxazol-3-yl]methyl]phenyl]carbamoylsulfanylamino]-2-[3-(trifluoromethoxy)phenyl]propyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC(C)(NSC(=O)Nc1c(N)cccc1CN1C=CO/C1=C1/CCCCN1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C31H38F3N5O5S/c1-29(2,3)27(40)43-19-30(4,21-10-8-11-22(17-21)44-31(32,33)34)38-45-28(41)37-25-20(9-7-12-23(25)35)18-39-15-16-42-26(39)24-13-5-6-14-36-24/h7-12,15-17,36,38H,5-6,13-14,18-19,35H2,1-4H3,(H,37,41)/b26-24- |
| InChIKey | HQMCMKKRJRJOGL-LCUIJRPUSA-N |
| XLogP | 6.69 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.74 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|