C21H25F2N3OS — CID 170950695
2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole;3-thiophen-2-yloxyazetidine (PubChem CID 170950695) has the molecular formula C21H25F2N3OS and a molecular weight of 405.51 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole;3-thiophen-2-yloxyazetidine.
| Compound Name | 2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole;3-thiophen-2-yloxyazetidine |
|---|---|
| PubChem CID | 170950695 |
| Molecular Formula | C21H25F2N3OS |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole;3-thiophen-2-yloxyazetidine |
| SMILES | CC1Cc2c([nH]c3ccccc23)CN1CC(F)F.c1csc(OC2CNC2)c1 |
| InChI | InChI=1S/C14H16F2N2.C7H9NOS/c1-9-6-11-10-4-2-3-5-12(10)17-13(11)7-18(9)8-14(15)16;1-2-7(10-3-1)9-6-4-8-5-6/h2-5,9,14,17H,6-8H2,1H3;1-3,6,8H,4-5H2 |
| InChIKey | CVMVONLCHJCVGH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|