C25H36N2O — CID 145102479
ethane;(2R)-2-methyl-3-[(3R)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol;toluene (PubChem CID 145102479) has the molecular formula C25H36N2O and a molecular weight of 380.58 g/mol. Its IUPAC name is ethane;(2R)-2-methyl-3-[(3R)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol;toluene.
| Compound Name | ethane;(2R)-2-methyl-3-[(3R)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol;toluene |
|---|---|
| PubChem CID | 145102479 |
| Molecular Formula | C25H36N2O |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | ethane;(2R)-2-methyl-3-[(3R)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol;toluene |
| SMILES | CC.C[C@@H](CO)CN1Cc2[nH]c3ccccc3c2C[C@H]1C.Cc1ccccc1 |
| InChI | InChI=1S/C16H22N2O.C7H8.C2H6/c1-11(10-19)8-18-9-16-14(7-12(18)2)13-5-3-4-6-15(13)17-16;1-7-5-3-2-4-6-7;1-2/h3-6,11-12,17,19H,7-10H2,1-2H3;2-6H,1H3;1-2H3/t11-,12-;;/m1../s1 |
| InChIKey | QAYKLNRWYJJYNL-MBORUXJMSA-N |
| XLogP | 5.56 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|