C18H21N5OS — CID 170951753
2-[2-methyl-4-(propan-2-ylamino)sulfanylanilino]spiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-6-one (PubChem CID 170951753) has the molecular formula C18H21N5OS and a molecular weight of 355.47 g/mol. Its IUPAC name is 2-[2-methyl-4-(propan-2-ylamino)sulfanylanilino]spiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-6-one.
| Compound Name | 2-[2-methyl-4-(propan-2-ylamino)sulfanylanilino]spiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-6-one |
|---|---|
| PubChem CID | 170951753 |
| Molecular Formula | C18H21N5OS |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-[2-methyl-4-(propan-2-ylamino)sulfanylanilino]spiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-6-one |
| SMILES | Cc1cc(SNC(C)C)ccc1Nc1ncc2c(n1)NC(=O)C21CC1 |
| InChI | InChI=1S/C18H21N5OS/c1-10(2)23-25-12-4-5-14(11(3)8-12)20-17-19-9-13-15(22-17)21-16(24)18(13)6-7-18/h4-5,8-10,23H,6-7H2,1-3H3,(H2,19,20,21,22,24) |
| InChIKey | BVUALKIEURAIEX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|