C7H13N5O — CID 170964871
4-[amino(methyl)amino]-2-methoxypyridine-3,5-diamine (PubChem CID 170964871) has the molecular formula C7H13N5O and a molecular weight of 183.22 g/mol. Its IUPAC name is 4-[amino(methyl)amino]-2-methoxypyridine-3,5-diamine.
| Compound Name | 4-[amino(methyl)amino]-2-methoxypyridine-3,5-diamine |
|---|---|
| PubChem CID | 170964871 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 4-[amino(methyl)amino]-2-methoxypyridine-3,5-diamine |
| SMILES | COc1ncc(N)c(N(C)N)c1N |
| InChI | InChI=1S/C7H13N5O/c1-12(10)6-4(8)3-11-7(13-2)5(6)9/h3H,8-10H2,1-2H3 |
| InChIKey | UBBAWBVMTNGQOM-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|