C27H57N3O5 — CID 170966754
ethane;N-[1-(3-methoxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl]formamide;N-[5-(propanoylamino)pentyl]hexanamide (PubChem CID 170966754) has the molecular formula C27H57N3O5 and a molecular weight of 503.77 g/mol. Its IUPAC name is ethane;N-[1-(3-methoxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl]formamide;N-[5-(propanoylamino)pentyl]hexanamide.
| Compound Name | ethane;N-[1-(3-methoxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl]formamide;N-[5-(propanoylamino)pentyl]hexanamide |
|---|---|
| PubChem CID | 170966754 |
| Molecular Formula | C27H57N3O5 |
| Molecular Weight | 503.77 g/mol |
| Exact Mass | 503.43 |
| IUPAC Name | ethane;N-[1-(3-methoxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl]formamide;N-[5-(propanoylamino)pentyl]hexanamide |
| SMILES | CC.CCCCCC(=O)NCCCCCNC(=O)CC.COCC(C)(C)COCC(C)(C)NC=O |
| InChI | InChI=1S/C14H28N2O2.C11H23NO3.C2H6/c1-3-5-7-10-14(18)16-12-9-6-8-11-15-13(17)4-2;1-10(2,6-14-5)7-15-8-11(3,4)12-9-13;1-2/h3-12H2,1-2H3,(H,15,17)(H,16,18);9H,6-8H2,1-5H3,(H,12,13);1-2H3 |
| InChIKey | VWAPVNHSXMEGIU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.77 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|