C20H26N2O — CID 170976831
3-methyl-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzohydrazide;molecular hydrogen (PubChem CID 170976831) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 3-methyl-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzohydrazide;molecular hydrogen.
| Compound Name | 3-methyl-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzohydrazide;molecular hydrogen |
|---|---|
| PubChem CID | 170976831 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 3-methyl-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzohydrazide;molecular hydrogen |
| SMILES | Cc1cccc(C(=O)NNC(C)c2ccc3c(c2)CCCC3)c1.[H][H] |
| InChI | InChI=1S/C20H24N2O.H2/c1-14-6-5-9-19(12-14)20(23)22-21-15(2)17-11-10-16-7-3-4-8-18(16)13-17;/h5-6,9-13,15,21H,3-4,7-8H2,1-2H3,(H,22,23);1H |
| InChIKey | LMDYYMNHTKQRMI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|