C24H22N2O3S — CID 170977145
[4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanylamino)phenyl]-(2,3-dihydroindol-1-yl)methanone (PubChem CID 170977145) has the molecular formula C24H22N2O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is [4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanylamino)phenyl]-(2,3-dihydroindol-1-yl)methanone.
| Compound Name | [4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanylamino)phenyl]-(2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 170977145 |
| Molecular Formula | C24H22N2O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | [4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanylamino)phenyl]-(2,3-dihydroindol-1-yl)methanone |
| SMILES | O=C(c1ccc(NSc2ccc3c(c2)OCCCO3)cc1)N1CCc2ccccc21 |
| InChI | InChI=1S/C24H22N2O3S/c27-24(26-13-12-17-4-1-2-5-21(17)26)18-6-8-19(9-7-18)25-30-20-10-11-22-23(16-20)29-15-3-14-28-22/h1-2,4-11,16,25H,3,12-15H2 |
| InChIKey | GIAIEHJXTYVFFB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|