C17H21F3N4O4 — CID 170982638
N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]bicyclo[1.1.1]pentane-1-carboxamide (PubChem CID 170982638) has the molecular formula C17H21F3N4O4 and a molecular weight of 402.37 g/mol. Its IUPAC name is N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]bicyclo[1.1.1]pentane-1-carboxamide.
| Compound Name | N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]bicyclo[1.1.1]pentane-1-carboxamide |
|---|---|
| PubChem CID | 170982638 |
| Molecular Formula | C17H21F3N4O4 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]bicyclo[1.1.1]pentane-1-carboxamide |
| SMILES | O=C(NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O)C12CC(C1)C2 |
| InChI | InChI=1S/C17H21F3N4O4/c18-17(19,20)11-5-21-6-12(24-11)23-9-7-28-10(14(26)13(9)25)4-22-15(27)16-1-8(2-16)3-16/h5-6,8-10,13-14,25-26H,1-4,7H2,(H,22,27)(H,23,24)/t8?,9-,10+,13+,14-,16?/m0/s1 |
| InChIKey | MGMYQIREPFPVQX-QBHYMLERSA-N |
| XLogP | 0.31 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |