C13H24N2O — CID 170991357
1,3-bis(1,2,2,3,3,4,4,5,5,6-decadeuteriocyclohexyl)urea (PubChem CID 170991357) has the molecular formula C13H24N2O and a molecular weight of 244.47 g/mol. Its IUPAC name is 1,3-bis(1,2,2,3,3,4,4,5,5,6-decadeuteriocyclohexyl)urea.
| Compound Name | 1,3-bis(1,2,2,3,3,4,4,5,5,6-decadeuteriocyclohexyl)urea |
|---|---|
| PubChem CID | 170991357 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 244.47 g/mol |
| Exact Mass | 244.31 |
| IUPAC Name | 1,3-bis(1,2,2,3,3,4,4,5,5,6-decadeuteriocyclohexyl)urea |
| SMILES | [2H]C1C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])NC(=O)NC1([2H])C([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C13H24N2O/c16-13(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h11-12H,1-10H2,(H2,14,15,16)/i1D2,2D2,3D2,4D2,5D2,6D2,7D,8D2,9D,10D2,11D,12D |
| InChIKey | ADFXKUOMJKEIND-BIRYXQITSA-N |
| XLogP | 2.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |