C9H8FIN2OS — CID 17100462
N-[(2-fluoro-4-iodophenyl)carbamothioyl]acetamide (PubChem CID 17100462) has the molecular formula C9H8FIN2OS and a molecular weight of 338.15 g/mol. Its IUPAC name is N-[(2-fluoro-4-iodophenyl)carbamothioyl]acetamide.
| Compound Name | N-[(2-fluoro-4-iodophenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 17100462 |
| Molecular Formula | C9H8FIN2OS |
| Molecular Weight | 338.15 g/mol |
| Exact Mass | 337.94 |
| IUPAC Name | N-[(2-fluoro-4-iodophenyl)carbamothioyl]acetamide |
| SMILES | CC(=O)NC(=S)Nc1ccc(I)cc1F |
| InChI | InChI=1S/C9H8FIN2OS/c1-5(14)12-9(15)13-8-3-2-6(11)4-7(8)10/h2-4H,1H3,(H2,12,13,14,15) |
| InChIKey | ZFXKDVSJBRJBPC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.15 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|