C63H55IrN3O-2 — CID 171051616
CID 171051616 (PubChem CID 171051616) has the molecular formula C63H55IrN3O-2 and a molecular weight of 1064.38 g/mol.
| Compound Name | CID 171051616 |
|---|---|
| PubChem CID | 171051616 |
| Molecular Formula | C63H55IrN3O-2 |
| Molecular Weight | 1064.38 g/mol |
| Exact Mass | 1064.41 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1ccnc1-c1[c-]ccc2c1oc1c2ccc2cc(-c3ccccc3)c3ccccc3c21.[2H]C([2H])(c1ccc(-c2[c-]cccc2)nc1)C(C)(C)C.[Ir] |
| InChI | InChI=1S/C47H37N2O.C16H18N.Ir/c1-29(2)40-27-34(31-14-7-5-8-15-31)28-41(30(3)4)44(40)49-25-24-48-47(49)39-21-13-20-37-38-23-22-33-26-42(32-16-9-6-10-17-32)35-18-11-12-19-36(35)43(33)46(38)50-45(37)39;1-16(2,3)11-13-9-10-15(17-12-13)14-7-5-4-6-8-14;/h5-20,22-30H,1-4H3;4-7,9-10,12H,11H2,1-3H3;/q2*-1;/i;11D2; |
| InChIKey | RDKJTLIYHNCJQH-YXZWVCJGSA-N |
| XLogP | 17.26 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1064.38 |
| LogP ≤ 5 | 17.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|