C44H23F3N2O2Pt — CID 171051642
CID 171051642 (PubChem CID 171051642) has the molecular formula C44H23F3N2O2Pt and a molecular weight of 863.75 g/mol.
| Compound Name | CID 171051642 |
|---|---|
| PubChem CID | 171051642 |
| Molecular Formula | C44H23F3N2O2Pt |
| Molecular Weight | 863.75 g/mol |
| Exact Mass | 863.14 |
| IUPAC Name | — |
| SMILES | FC(F)=C(F)c1ccc(-c2ccc3ccc4c(ccc5oc6c(-c7ccccn7)[c-]c(Oc7[c-]c(-c8ccccn8)ccc7)cc6c54)c3c2)cc1.[Pt+2] |
| InChI | InChI=1S/C44H23F3N2O2.Pt/c45-42(44(46)47)28-13-10-26(11-14-28)29-15-12-27-16-17-34-33(35(27)23-29)18-19-40-41(34)37-25-32(24-36(43(37)51-40)39-9-2-4-21-49-39)50-31-7-5-6-30(22-31)38-8-1-3-20-48-38;/h1-21,23,25H;/q-2;+2 |
| InChIKey | WJZBVAWMJWUOIA-UHFFFAOYSA-N |
| XLogP | 12.61 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.75 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|