C55H99NO12 — CID 171051974
tert-butyl 3-[2-[2,3-bis[5-(2-hexyldecanoyloxy)pentanoyloxy]propoxy]-2-oxoethyl]azetidine-1-carboxylate (PubChem CID 171051974) has the molecular formula C55H99NO12 and a molecular weight of 966.39 g/mol. Its IUPAC name is tert-butyl 3-[2-[2,3-bis[5-(2-hexyldecanoyloxy)pentanoyloxy]propoxy]-2-oxoethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[2,3-bis[5-(2-hexyldecanoyloxy)pentanoyloxy]propoxy]-2-oxoethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 171051974 |
| Molecular Formula | C55H99NO12 |
| Molecular Weight | 966.39 g/mol |
| Exact Mass | 965.72 |
| IUPAC Name | tert-butyl 3-[2-[2,3-bis[5-(2-hexyldecanoyloxy)pentanoyloxy]propoxy]-2-oxoethyl]azetidine-1-carboxylate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCC(=O)OCC(COC(=O)CC1CN(C(=O)OC(C)(C)C)C1)OC(=O)CCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C55H99NO12/c1-8-12-16-20-22-26-34-46(32-24-18-14-10-3)52(60)63-38-30-28-36-49(57)65-43-48(44-66-51(59)40-45-41-56(42-45)54(62)68-55(5,6)7)67-50(58)37-29-31-39-64-53(61)47(33-25-19-15-11-4)35-27-23-21-17-13-9-2/h45-48H,8-44H2,1-7H3 |
| InChIKey | OXIFJOKZKNIJLZ-UHFFFAOYSA-N |
| XLogP | 13.34 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 966.39 |
| LogP ≤ 5 | 13.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|